C27H27Cl2N3O — CID 3887884
2-(3,4-dichlorophenyl)-6-(4-methylphenyl)-N-propyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 3887884) has the molecular formula C27H27Cl2N3O and a molecular weight of 480.44 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-6-(4-methylphenyl)-N-propyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-6-(4-methylphenyl)-N-propyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 3887884 |
| Molecular Formula | C27H27Cl2N3O |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-6-(4-methylphenyl)-N-propyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | CCCNC(=O)c1c(-c2ccc(C)cc2)c2c3n(c(-c4ccc(Cl)c(Cl)c4)cn13)CCCC2 |
| InChI | InChI=1S/C27H27Cl2N3O/c1-3-13-30-26(33)25-24(18-9-7-17(2)8-10-18)20-6-4-5-14-31-23(16-32(25)27(20)31)19-11-12-21(28)22(29)15-19/h7-12,15-16H,3-6,13-14H2,1-2H3,(H,30,33) |
| InChIKey | QFCLGIVJGNWYAB-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 38.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |