C29H26N4O2 — CID 3758094
6-(4-methoxyphenyl)-N,2-diphenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 3758094) has the molecular formula C29H26N4O2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-N,2-diphenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | 6-(4-methoxyphenyl)-N,2-diphenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 3758094 |
| Molecular Formula | C29H26N4O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 6-(4-methoxyphenyl)-N,2-diphenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | COc1ccc(-c2c3c4n(c(-c5ccccc5)nn4c2C(=O)Nc2ccccc2)CCCC3)cc1 |
| InChI | InChI=1S/C29H26N4O2/c1-35-23-17-15-20(16-18-23)25-24-14-8-9-19-32-27(21-10-4-2-5-11-21)31-33(29(24)32)26(25)28(34)30-22-12-6-3-7-13-22/h2-7,10-13,15-18H,8-9,14,19H2,1H3,(H,30,34) |
| InChIKey | ZKGUGXMPCWJYFA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |