C29H32N4O2 — CID 2112168
N-cyclohexyl-2-(2-methoxyphenyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 2112168) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-methoxyphenyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | N-cyclohexyl-2-(2-methoxyphenyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 2112168 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-cyclohexyl-2-(2-methoxyphenyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | COc1ccccc1-c1nn2c(C(=O)NC3CCCCC3)c(-c3ccccc3)c3c2n1CCCC3 |
| InChI | InChI=1S/C29H32N4O2/c1-35-24-18-9-8-16-22(24)27-31-33-26(28(34)30-21-14-6-3-7-15-21)25(20-12-4-2-5-13-20)23-17-10-11-19-32(27)29(23)33/h2,4-5,8-9,12-13,16,18,21H,3,6-7,10-11,14-15,17,19H2,1H3,(H,30,34) |
| InChIKey | PMUCZWWMTUJAHT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |