C29H24Cl2N4S — CID 3619452
N-(3,4-dichlorophenyl)-6-(4-methylphenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 3619452) has the molecular formula C29H24Cl2N4S and a molecular weight of 531.51 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-(4-methylphenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | N-(3,4-dichlorophenyl)-6-(4-methylphenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 3619452 |
| Molecular Formula | C29H24Cl2N4S |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-(4-methylphenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | Cc1ccc(-c2c3c4n(c(-c5ccccc5)nn4c2C(=S)Nc2ccc(Cl)c(Cl)c2)CCCC3)cc1 |
| InChI | InChI=1S/C29H24Cl2N4S/c1-18-10-12-19(13-11-18)25-22-9-5-6-16-34-27(20-7-3-2-4-8-20)33-35(29(22)34)26(25)28(36)32-21-14-15-23(30)24(31)17-21/h2-4,7-8,10-15,17H,5-6,9,16H2,1H3,(H,32,36) |
| InChIKey | PSIKXAQEKHKTQZ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 34.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|