C31H29ClN4S — CID 34883125
N-(3-chloro-2-methylphenyl)-2,6-bis(4-methylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 34883125) has the molecular formula C31H29ClN4S and a molecular weight of 525.12 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2,6-bis(4-methylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2,6-bis(4-methylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 34883125 |
| Molecular Formula | C31H29ClN4S |
| Molecular Weight | 525.12 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2,6-bis(4-methylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | Cc1ccc(-c2c3c4n(c(-c5ccc(C)cc5)nn4c2C(=S)Nc2cccc(Cl)c2C)CCCC3)cc1 |
| InChI | InChI=1S/C31H29ClN4S/c1-19-10-14-22(15-11-19)27-24-7-4-5-18-35-29(23-16-12-20(2)13-17-23)34-36(31(24)35)28(27)30(37)33-26-9-6-8-25(32)21(26)3/h6,8-17H,4-5,7,18H2,1-3H3,(H,33,37) |
| InChIKey | BMCWVRMJUHFCAY-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 34.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.12 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|