C30H27ClN4S — CID 34637933
6-(4-chlorophenyl)-N-(4-ethylphenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 34637933) has the molecular formula C30H27ClN4S and a molecular weight of 511.09 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(4-ethylphenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 6-(4-chlorophenyl)-N-(4-ethylphenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 34637933 |
| Molecular Formula | C30H27ClN4S |
| Molecular Weight | 511.09 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(4-ethylphenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | CCc1ccc(NC(=S)c2c(-c3ccc(Cl)cc3)c3c4n(c(-c5ccccc5)nn24)CCCC3)cc1 |
| InChI | InChI=1S/C30H27ClN4S/c1-2-20-11-17-24(18-12-20)32-29(36)27-26(21-13-15-23(31)16-14-21)25-10-6-7-19-34-28(33-35(27)30(25)34)22-8-4-3-5-9-22/h3-5,8-9,11-18H,2,6-7,10,19H2,1H3,(H,32,36) |
| InChIKey | JNQFEEJGEMZAFJ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 34.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.09 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|