C30H27BrClN5S — CID 45129289
6-(4-bromophenyl)-2-[(3-chloro-2-methylanilino)methyl]-N-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 45129289) has the molecular formula C30H27BrClN5S and a molecular weight of 605.01 g/mol. Its IUPAC name is 6-(4-bromophenyl)-2-[(3-chloro-2-methylanilino)methyl]-N-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 6-(4-bromophenyl)-2-[(3-chloro-2-methylanilino)methyl]-N-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 45129289 |
| Molecular Formula | C30H27BrClN5S |
| Molecular Weight | 605.01 g/mol |
| Exact Mass | 603.09 |
| IUPAC Name | 6-(4-bromophenyl)-2-[(3-chloro-2-methylanilino)methyl]-N-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | Cc1c(Cl)cccc1NCc1nn2c(C(=S)Nc3ccccc3)c(-c3ccc(Br)cc3)c3c2n1CCCC3 |
| InChI | InChI=1S/C30H27BrClN5S/c1-19-24(32)11-7-12-25(19)33-18-26-35-37-28(29(38)34-22-8-3-2-4-9-22)27(20-13-15-21(31)16-14-20)23-10-5-6-17-36(26)30(23)37/h2-4,7-9,11-16,33H,5-6,10,17-18H2,1H3,(H,34,38) |
| InChIKey | KEAPXIKNUFKXJI-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 46.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.01 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|