C31H27BrCl2N4O2S — CID 44788694
6-(4-bromophenyl)-2-[(2,4-dichlorophenoxy)methyl]-N-(4-ethoxyphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 44788694) has the molecular formula C31H27BrCl2N4O2S and a molecular weight of 670.46 g/mol. Its IUPAC name is 6-(4-bromophenyl)-2-[(2,4-dichlorophenoxy)methyl]-N-(4-ethoxyphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 6-(4-bromophenyl)-2-[(2,4-dichlorophenoxy)methyl]-N-(4-ethoxyphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 44788694 |
| Molecular Formula | C31H27BrCl2N4O2S |
| Molecular Weight | 670.46 g/mol |
| Exact Mass | 668.04 |
| IUPAC Name | 6-(4-bromophenyl)-2-[(2,4-dichlorophenoxy)methyl]-N-(4-ethoxyphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | CCOc1ccc(NC(=S)c2c(-c3ccc(Br)cc3)c3c4n(c(COc5ccc(Cl)cc5Cl)nn24)CCCC3)cc1 |
| InChI | InChI=1S/C31H27BrCl2N4O2S/c1-2-39-23-13-11-22(12-14-23)35-30(41)29-28(19-6-8-20(32)9-7-19)24-5-3-4-16-37-27(36-38(29)31(24)37)18-40-26-15-10-21(33)17-25(26)34/h6-15,17H,2-5,16,18H2,1H3,(H,35,41) |
| InChIKey | DDOIGJZRKQSZFC-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 52.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.46 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|