C34H33BrN4O3S2 — CID 3680126
ethyl 2-[[6-(4-bromophenyl)-2-(phenoxymethyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3680126) has the molecular formula C34H33BrN4O3S2 and a molecular weight of 689.70 g/mol. Its IUPAC name is ethyl 2-[[6-(4-bromophenyl)-2-(phenoxymethyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[6-(4-bromophenyl)-2-(phenoxymethyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3680126 |
| Molecular Formula | C34H33BrN4O3S2 |
| Molecular Weight | 689.70 g/mol |
| Exact Mass | 688.12 |
| IUPAC Name | ethyl 2-[[6-(4-bromophenyl)-2-(phenoxymethyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)c2c(-c3ccc(Br)cc3)c3c4n(c(COc5ccccc5)nn24)CCCC3)sc2c1CCCC2 |
| InChI | InChI=1S/C34H33BrN4O3S2/c1-2-41-34(40)29-24-12-6-7-14-26(24)44-32(29)36-31(43)30-28(21-15-17-22(35)18-16-21)25-13-8-9-19-38-27(37-39(30)33(25)38)20-42-23-10-4-3-5-11-23/h3-5,10-11,15-18H,2,6-9,12-14,19-20H2,1H3,(H,36,43) |
| InChIKey | JIVMGOUNFLKMTP-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.70 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|