C31H27ClFN3O2 — CID 2353170
[6-(4-chlorophenyl)-2-[(2-fluorophenoxy)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]-(2,5-dimethylphenyl)methanone (PubChem CID 2353170) has the molecular formula C31H27ClFN3O2 and a molecular weight of 528.03 g/mol. Its IUPAC name is [6-(4-chlorophenyl)-2-[(2-fluorophenoxy)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]-(2,5-dimethylphenyl)methanone.
| Compound Name | [6-(4-chlorophenyl)-2-[(2-fluorophenoxy)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]-(2,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 2353170 |
| Molecular Formula | C31H27ClFN3O2 |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | [6-(4-chlorophenyl)-2-[(2-fluorophenoxy)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]-(2,5-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)c2c(-c3ccc(Cl)cc3)c3c4n(c(COc5ccccc5F)nn24)CCCC3)c1 |
| InChI | InChI=1S/C31H27ClFN3O2/c1-19-10-11-20(2)24(17-19)30(37)29-28(21-12-14-22(32)15-13-21)23-7-5-6-16-35-27(34-36(29)31(23)35)18-38-26-9-4-3-8-25(26)33/h3-4,8-15,17H,5-7,16,18H2,1-2H3 |
| InChIKey | JAEYNLAYUZGHBM-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |