C29H31ClN4O2 — CID 34319421
N-(5-chloro-2-methylphenyl)-N-[(6-phenyl-5-propanoyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-2-yl)methyl]propanamide (PubChem CID 34319421) has the molecular formula C29H31ClN4O2 and a molecular weight of 503.05 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-N-[(6-phenyl-5-propanoyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-2-yl)methyl]propanamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-N-[(6-phenyl-5-propanoyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 34319421 |
| Molecular Formula | C29H31ClN4O2 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-N-[(6-phenyl-5-propanoyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-2-yl)methyl]propanamide |
| SMILES | CCC(=O)c1c(-c2ccccc2)c2c3n(c(CN(C(=O)CC)c4cc(Cl)ccc4C)nn13)CCCC2 |
| InChI | InChI=1S/C29H31ClN4O2/c1-4-24(35)28-27(20-11-7-6-8-12-20)22-13-9-10-16-32-25(31-34(28)29(22)32)18-33(26(36)5-2)23-17-21(30)15-14-19(23)3/h6-8,11-12,14-15,17H,4-5,9-10,13,16,18H2,1-3H3 |
| InChIKey | QLGDGQHBMOKEHD-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |