C28H22ClFN4S — CID 2380449
6-(4-chlorophenyl)-N-(2-fluorophenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 2380449) has the molecular formula C28H22ClFN4S and a molecular weight of 501.03 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(2-fluorophenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 6-(4-chlorophenyl)-N-(2-fluorophenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 2380449 |
| Molecular Formula | C28H22ClFN4S |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(2-fluorophenyl)-2-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | Fc1ccccc1NC(=S)c1c(-c2ccc(Cl)cc2)c2c3n(c(-c4ccccc4)nn13)CCCC2 |
| InChI | InChI=1S/C28H22ClFN4S/c29-20-15-13-18(14-16-20)24-21-10-6-7-17-33-26(19-8-2-1-3-9-19)32-34(28(21)33)25(24)27(35)31-23-12-5-4-11-22(23)30/h1-5,8-9,11-16H,6-7,10,17H2,(H,31,35) |
| InChIKey | CVXHMNUCZCHYQU-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 34.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|