C29H22Cl3N3S — CID 5296483
N,2,6-tris(4-chlorophenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 5296483) has the molecular formula C29H22Cl3N3S and a molecular weight of 550.94 g/mol. Its IUPAC name is N,2,6-tris(4-chlorophenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | N,2,6-tris(4-chlorophenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 5296483 |
| Molecular Formula | C29H22Cl3N3S |
| Molecular Weight | 550.94 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | N,2,6-tris(4-chlorophenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)cc1)c1c(-c2ccc(Cl)cc2)c2c3n(c(-c4ccc(Cl)cc4)cn13)CCCC2 |
| InChI | InChI=1S/C29H22Cl3N3S/c30-20-8-4-18(5-9-20)25-17-35-27(28(36)33-23-14-12-22(32)13-15-23)26(19-6-10-21(31)11-7-19)24-3-1-2-16-34(25)29(24)35/h4-15,17H,1-3,16H2,(H,33,36) |
| InChIKey | SKYIECRBCCQOBQ-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 21.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.94 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|