C30H25ClN4O2S — CID 2447647
N-(4-chlorophenyl)-2-(4-methylphenyl)-6-(4-nitrophenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 2447647) has the molecular formula C30H25ClN4O2S and a molecular weight of 541.08 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(4-methylphenyl)-6-(4-nitrophenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-2-(4-methylphenyl)-6-(4-nitrophenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 2447647 |
| Molecular Formula | C30H25ClN4O2S |
| Molecular Weight | 541.08 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | N-(4-chlorophenyl)-2-(4-methylphenyl)-6-(4-nitrophenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | Cc1ccc(-c2cn3c(C(=S)Nc4ccc(Cl)cc4)c(-c4ccc([N+](=O)[O-])cc4)c4c3n2CCCC4)cc1 |
| InChI | InChI=1S/C30H25ClN4O2S/c1-19-5-7-20(8-6-19)26-18-34-28(29(38)32-23-13-11-22(31)12-14-23)27(21-9-15-24(16-10-21)35(36)37)25-4-2-3-17-33(26)30(25)34/h5-16,18H,2-4,17H2,1H3,(H,32,38) |
| InChIKey | BEHCVDANIDCXJX-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.08 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|