C31H28BrN3S — CID 45129372
2-(4-bromophenyl)-N-(2,3-dimethylphenyl)-6-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 45129372) has the molecular formula C31H28BrN3S and a molecular weight of 554.56 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(2,3-dimethylphenyl)-6-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 2-(4-bromophenyl)-N-(2,3-dimethylphenyl)-6-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 45129372 |
| Molecular Formula | C31H28BrN3S |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 2-(4-bromophenyl)-N-(2,3-dimethylphenyl)-6-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | Cc1cccc(NC(=S)c2c(-c3ccccc3)c3c4n(c(-c5ccc(Br)cc5)cn24)CCCC3)c1C |
| InChI | InChI=1S/C31H28BrN3S/c1-20-9-8-13-26(21(20)2)33-30(36)29-28(23-10-4-3-5-11-23)25-12-6-7-18-34-27(19-35(29)31(25)34)22-14-16-24(32)17-15-22/h3-5,8-11,13-17,19H,6-7,12,18H2,1-2H3,(H,33,36) |
| InChIKey | KCLCBMRJOBRFCM-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 21.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|