C31H29ClN4O2S — CID 4649262
2-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)-6-(4-methylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 4649262) has the molecular formula C31H29ClN4O2S and a molecular weight of 557.12 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)-6-(4-methylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 2-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)-6-(4-methylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 4649262 |
| Molecular Formula | C31H29ClN4O2S |
| Molecular Weight | 557.12 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)-6-(4-methylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | COc1ccc(OC)c(NC(=S)c2c(-c3ccc(C)cc3)c3c4n(c(-c5ccc(Cl)cc5)nn24)CCCC3)c1 |
| InChI | InChI=1S/C31H29ClN4O2S/c1-19-7-9-20(10-8-19)27-24-6-4-5-17-35-29(21-11-13-22(32)14-12-21)34-36(31(24)35)28(27)30(39)33-25-18-23(37-2)15-16-26(25)38-3/h7-16,18H,4-6,17H2,1-3H3,(H,33,39) |
| InChIKey | ZXLASLFEGYFRDC-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 52.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.12 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|