C30H34ClN5S — CID 2375876
6-(4-chlorophenyl)-N-cyclohexyl-2-[(4-methylanilino)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 2375876) has the molecular formula C30H34ClN5S and a molecular weight of 532.16 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-cyclohexyl-2-[(4-methylanilino)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 6-(4-chlorophenyl)-N-cyclohexyl-2-[(4-methylanilino)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 2375876 |
| Molecular Formula | C30H34ClN5S |
| Molecular Weight | 532.16 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 6-(4-chlorophenyl)-N-cyclohexyl-2-[(4-methylanilino)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | Cc1ccc(NCc2nn3c(C(=S)NC4CCCCC4)c(-c4ccc(Cl)cc4)c4c3n2CCCC4)cc1 |
| InChI | InChI=1S/C30H34ClN5S/c1-20-10-16-23(17-11-20)32-19-26-34-36-28(29(37)33-24-7-3-2-4-8-24)27(21-12-14-22(31)15-13-21)25-9-5-6-18-35(26)30(25)36/h10-17,24,32H,2-9,18-19H2,1H3,(H,33,37) |
| InChIKey | QVPOTJFYTOCKPW-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 46.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.16 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|