C26H25ClFN5S — CID 171114818
2-[(4-chloroanilino)methyl]-6-(4-fluorophenyl)-N-prop-2-enyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 171114818) has the molecular formula C26H25ClFN5S and a molecular weight of 494.04 g/mol. Its IUPAC name is 2-[(4-chloroanilino)methyl]-6-(4-fluorophenyl)-N-prop-2-enyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 2-[(4-chloroanilino)methyl]-6-(4-fluorophenyl)-N-prop-2-enyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 171114818 |
| Molecular Formula | C26H25ClFN5S |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-[(4-chloroanilino)methyl]-6-(4-fluorophenyl)-N-prop-2-enyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | C=CCNC(=S)c1c(-c2ccc(F)cc2)c2c3n(c(CNc4ccc(Cl)cc4)nn13)CCCC2 |
| InChI | InChI=1S/C26H25ClFN5S/c1-2-14-29-25(34)24-23(17-6-10-19(28)11-7-17)21-5-3-4-15-32-22(31-33(24)26(21)32)16-30-20-12-8-18(27)9-13-20/h2,6-13,30H,1,3-5,14-16H2,(H,29,34) |
| InChIKey | BFZCNTRKPGQVQO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 46.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|