C30H26Cl3N5S — CID 45129540
N-benzyl-2-[(4-chloroanilino)methyl]-6-(3,4-dichlorophenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 45129540) has the molecular formula C30H26Cl3N5S and a molecular weight of 595.00 g/mol. Its IUPAC name is N-benzyl-2-[(4-chloroanilino)methyl]-6-(3,4-dichlorophenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | N-benzyl-2-[(4-chloroanilino)methyl]-6-(3,4-dichlorophenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 45129540 |
| Molecular Formula | C30H26Cl3N5S |
| Molecular Weight | 595.00 g/mol |
| Exact Mass | 593.10 |
| IUPAC Name | N-benzyl-2-[(4-chloroanilino)methyl]-6-(3,4-dichlorophenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | S=C(NCc1ccccc1)c1c(-c2ccc(Cl)c(Cl)c2)c2c3n(c(CNc4ccc(Cl)cc4)nn13)CCCC2 |
| InChI | InChI=1S/C30H26Cl3N5S/c31-21-10-12-22(13-11-21)34-18-26-36-38-28(29(39)35-17-19-6-2-1-3-7-19)27(20-9-14-24(32)25(33)16-20)23-8-4-5-15-37(26)30(23)38/h1-3,6-7,9-14,16,34H,4-5,8,15,17-18H2,(H,35,39) |
| InChIKey | GNWJJOLSCWKNAY-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 46.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.00 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|