C33H40ClN5O2S — CID 5064664
2-[(4-tert-butylphenoxy)methyl]-6-(4-chlorophenyl)-N-(2-morpholin-4-ylethyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 5064664) has the molecular formula C33H40ClN5O2S and a molecular weight of 606.24 g/mol. Its IUPAC name is 2-[(4-tert-butylphenoxy)methyl]-6-(4-chlorophenyl)-N-(2-morpholin-4-ylethyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 2-[(4-tert-butylphenoxy)methyl]-6-(4-chlorophenyl)-N-(2-morpholin-4-ylethyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 5064664 |
| Molecular Formula | C33H40ClN5O2S |
| Molecular Weight | 606.24 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 2-[(4-tert-butylphenoxy)methyl]-6-(4-chlorophenyl)-N-(2-morpholin-4-ylethyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | CC(C)(C)c1ccc(OCc2nn3c(C(=S)NCCN4CCOCC4)c(-c4ccc(Cl)cc4)c4c3n2CCCC4)cc1 |
| InChI | InChI=1S/C33H40ClN5O2S/c1-33(2,3)24-9-13-26(14-10-24)41-22-28-36-39-30(31(42)35-15-17-37-18-20-40-21-19-37)29(23-7-11-25(34)12-8-23)27-6-4-5-16-38(28)32(27)39/h7-14H,4-6,15-22H2,1-3H3,(H,35,42) |
| InChIKey | HFWDGBWIKRMNQN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 55.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.24 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|