C31H29ClFN5S — CID 16761418
6-(4-chlorophenyl)-N-(2,5-dimethylphenyl)-2-[(4-fluoroanilino)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 16761418) has the molecular formula C31H29ClFN5S and a molecular weight of 558.13 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(2,5-dimethylphenyl)-2-[(4-fluoroanilino)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 6-(4-chlorophenyl)-N-(2,5-dimethylphenyl)-2-[(4-fluoroanilino)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 16761418 |
| Molecular Formula | C31H29ClFN5S |
| Molecular Weight | 558.13 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(2,5-dimethylphenyl)-2-[(4-fluoroanilino)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | Cc1ccc(C)c(NC(=S)c2c(-c3ccc(Cl)cc3)c3c4n(c(CNc5ccc(F)cc5)nn24)CCCC3)c1 |
| InChI | InChI=1S/C31H29ClFN5S/c1-19-6-7-20(2)26(17-19)35-30(39)29-28(21-8-10-22(32)11-9-21)25-5-3-4-16-37-27(36-38(29)31(25)37)18-34-24-14-12-23(33)13-15-24/h6-15,17,34H,3-5,16,18H2,1-2H3,(H,35,39) |
| InChIKey | HOFYLMNSWSTNIF-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 46.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.13 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|