C26H26FN5S — CID 4111359
2-[(4-fluoroanilino)methyl]-6-phenyl-N-prop-2-enyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 4111359) has the molecular formula C26H26FN5S and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-[(4-fluoroanilino)methyl]-6-phenyl-N-prop-2-enyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 2-[(4-fluoroanilino)methyl]-6-phenyl-N-prop-2-enyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 4111359 |
| Molecular Formula | C26H26FN5S |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-[(4-fluoroanilino)methyl]-6-phenyl-N-prop-2-enyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | C=CCNC(=S)c1c(-c2ccccc2)c2c3n(c(CNc4ccc(F)cc4)nn13)CCCC2 |
| InChI | InChI=1S/C26H26FN5S/c1-2-15-28-25(33)24-23(18-8-4-3-5-9-18)21-10-6-7-16-31-22(30-32(24)26(21)31)17-29-20-13-11-19(27)12-14-20/h2-5,8-9,11-14,29H,1,6-7,10,15-17H2,(H,28,33) |
| InChIKey | HYYXZCLAQNNVRT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|