C31H38N4OS — CID 2345392
N-[(2S)-2-ethylhexyl]-2-(phenoxymethyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 2345392) has the molecular formula C31H38N4OS and a molecular weight of 514.74 g/mol. Its IUPAC name is N-[(2S)-2-ethylhexyl]-2-(phenoxymethyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | N-[(2S)-2-ethylhexyl]-2-(phenoxymethyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 2345392 |
| Molecular Formula | C31H38N4OS |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | N-[(2S)-2-ethylhexyl]-2-(phenoxymethyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | CCCC[C@H](CC)CNC(=S)c1c(-c2ccccc2)c2c3n(c(COc4ccccc4)nn13)CCCC2 |
| InChI | InChI=1S/C31H38N4OS/c1-3-5-14-23(4-2)21-32-30(37)29-28(24-15-8-6-9-16-24)26-19-12-13-20-34-27(33-35(29)31(26)34)22-36-25-17-10-7-11-18-25/h6-11,15-18,23H,3-5,12-14,19-22H2,1-2H3,(H,32,37)/t23-/m0/s1 |
| InChIKey | PFXDYVDZNYLXQD-QHCPKHFHSA-N |
| XLogP | 7.20 |
| TPSA | 43.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|