C37H42N4OS — CID 2409076
6-(4-methylphenyl)-2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-(2-propan-2-ylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 2409076) has the molecular formula C37H42N4OS and a molecular weight of 590.84 g/mol. Its IUPAC name is 6-(4-methylphenyl)-2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-(2-propan-2-ylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 6-(4-methylphenyl)-2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-(2-propan-2-ylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 2409076 |
| Molecular Formula | C37H42N4OS |
| Molecular Weight | 590.84 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | 6-(4-methylphenyl)-2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-(2-propan-2-ylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | Cc1ccc(-c2c3c4n(c(COc5cc(C)ccc5C(C)C)nn4c2C(=S)Nc2ccccc2C(C)C)CCCC3)cc1 |
| InChI | InChI=1S/C37H42N4OS/c1-23(2)28-11-7-8-13-31(28)38-36(43)35-34(27-17-14-25(5)15-18-27)30-12-9-10-20-40-33(39-41(35)37(30)40)22-42-32-21-26(6)16-19-29(32)24(3)4/h7-8,11,13-19,21,23-24H,9-10,12,20,22H2,1-6H3,(H,38,43) |
| InChIKey | PVEANWSHZXOGQW-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 43.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.84 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|