C29H25Br2N5O — CID 23994680
2-[(4-bromoanilino)methyl]-6-(4-bromophenyl)-N-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 23994680) has the molecular formula C29H25Br2N5O and a molecular weight of 619.36 g/mol. Its IUPAC name is 2-[(4-bromoanilino)methyl]-6-(4-bromophenyl)-N-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | 2-[(4-bromoanilino)methyl]-6-(4-bromophenyl)-N-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 23994680 |
| Molecular Formula | C29H25Br2N5O |
| Molecular Weight | 619.36 g/mol |
| Exact Mass | 617.04 |
| IUPAC Name | 2-[(4-bromoanilino)methyl]-6-(4-bromophenyl)-N-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1c(-c2ccc(Br)cc2)c2c3n(c(CNc4ccc(Br)cc4)nn13)CCCC2 |
| InChI | InChI=1S/C29H25Br2N5O/c30-20-11-9-19(10-12-20)26-24-8-4-5-17-35-25(18-32-22-15-13-21(31)14-16-22)34-36(29(24)35)27(26)28(37)33-23-6-2-1-3-7-23/h1-3,6-7,9-16,32H,4-5,8,17-18H2,(H,33,37) |
| InChIKey | XIQCQYRQOMRDGE-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 63.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.36 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |