C29H32FN5S — CID 2330328
N-cyclohexyl-2-[(4-fluoroanilino)methyl]-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 2330328) has the molecular formula C29H32FN5S and a molecular weight of 501.68 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4-fluoroanilino)methyl]-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | N-cyclohexyl-2-[(4-fluoroanilino)methyl]-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 2330328 |
| Molecular Formula | C29H32FN5S |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | N-cyclohexyl-2-[(4-fluoroanilino)methyl]-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | Fc1ccc(NCc2nn3c(C(=S)NC4CCCCC4)c(-c4ccccc4)c4c3n2CCCC4)cc1 |
| InChI | InChI=1S/C29H32FN5S/c30-21-14-16-22(17-15-21)31-19-25-33-35-27(28(36)32-23-11-5-2-6-12-23)26(20-9-3-1-4-10-20)24-13-7-8-18-34(25)29(24)35/h1,3-4,9-10,14-17,23,31H,2,5-8,11-13,18-19H2,(H,32,36) |
| InChIKey | XNCZFTZUMWKEKI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 46.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|