C16H27NO2 — CID 90949798
2-(2-ethylhexyl)-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 90949798) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-(2-ethylhexyl)-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 90949798 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-(2-ethylhexyl)-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | CCCCC(CC)Cn1c(O)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C16H27NO2/c1-3-5-8-12(4-2)11-17-15(18)13-9-6-7-10-14(13)16(17)19/h12,18-19H,3-11H2,1-2H3 |
| InChIKey | HMRBADMJPQVDIH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |