C17H33N2+ — CID 89448985
1-(2-ethylhexyl)-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium (PubChem CID 89448985) has the molecular formula C17H33N2+ and a molecular weight of 265.46 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium.
| Compound Name | 1-(2-ethylhexyl)-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium |
|---|---|
| PubChem CID | 89448985 |
| Molecular Formula | C17H33N2+ |
| Molecular Weight | 265.46 g/mol |
| Exact Mass | 265.26 |
| IUPAC Name | 1-(2-ethylhexyl)-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium |
| SMILES | CCCCC(CC)CN1CCC[N+]2=C1CCCCC2 |
| InChI | InChI=1S/C17H33N2/c1-3-5-10-16(4-2)15-19-14-9-13-18-12-8-6-7-11-17(18)19/h16H,3-15H2,1-2H3/q+1 |
| InChIKey | IRRZRYZEHKBSDP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|