C30H24Cl2N2O2 — CID 2509814
(2,4-dichlorophenyl)-[2-(4-methoxyphenyl)-6-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]methanone (PubChem CID 2509814) has the molecular formula C30H24Cl2N2O2 and a molecular weight of 515.44 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-[2-(4-methoxyphenyl)-6-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]methanone.
| Compound Name | (2,4-dichlorophenyl)-[2-(4-methoxyphenyl)-6-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]methanone |
|---|---|
| PubChem CID | 2509814 |
| Molecular Formula | C30H24Cl2N2O2 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | (2,4-dichlorophenyl)-[2-(4-methoxyphenyl)-6-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]methanone |
| SMILES | COc1ccc(-c2cn3c(C(=O)c4ccc(Cl)cc4Cl)c(-c4ccccc4)c4c3n2CCCC4)cc1 |
| InChI | InChI=1S/C30H24Cl2N2O2/c1-36-22-13-10-19(11-14-22)26-18-34-28(29(35)23-15-12-21(31)17-25(23)32)27(20-7-3-2-4-8-20)24-9-5-6-16-33(26)30(24)34/h2-4,7-8,10-15,17-18H,5-6,9,16H2,1H3 |
| InChIKey | JGAFZIMLIVCWSN-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |