C24H40N8O8S — CID 23178520
2-[[2-[[2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]propanoylamino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 23178520) has the molecular formula C24H40N8O8S and a molecular weight of 600.70 g/mol. Its IUPAC name is 2-[[2-[[2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]propanoylamino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]propanoylamino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 23178520 |
| Molecular Formula | C24H40N8O8S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 2-[[2-[[2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]propanoylamino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(C(=O)NC(C)C(=O)NCC(=O)NC(Cc1cnc[nH]1)C(=O)NC(CS)C(=O)O)C(C)O |
| InChI | InChI=1S/C24H40N8O8S/c1-11(2)5-15(25)21(36)32-19(13(4)33)23(38)29-12(3)20(35)27-8-18(34)30-16(6-14-7-26-10-28-14)22(37)31-17(9-41)24(39)40/h7,10-13,15-17,19,33,41H,5-6,8-9,25H2,1-4H3,(H,26,28)(H,27,35)(H,29,38)(H,30,34)(H,31,37)(H,32,36)(H,39,40) |
| InChIKey | NBYVOOVVLAWWLJ-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 257.73 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|