C19H23NO3 — CID 23184440
(Z)-2-(1,3,3a,4,7,7a-hexahydroisoindol-2-ylmethyl)-3-(4-methoxyphenyl)prop-2-enoic acid (PubChem CID 23184440) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (Z)-2-(1,3,3a,4,7,7a-hexahydroisoindol-2-ylmethyl)-3-(4-methoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(1,3,3a,4,7,7a-hexahydroisoindol-2-ylmethyl)-3-(4-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 23184440 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (Z)-2-(1,3,3a,4,7,7a-hexahydroisoindol-2-ylmethyl)-3-(4-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C=C(/CN2CC3CC=CCC3C2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-23-18-8-6-14(7-9-18)10-17(19(21)22)13-20-11-15-4-2-3-5-16(15)12-20/h2-3,6-10,15-16H,4-5,11-13H2,1H3,(H,21,22)/b17-10- |
| InChIKey | HQZJYTPJTYVCRH-YVLHZVERSA-N |
| XLogP | 3.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|