C19H18F6N2O — CID 23186940
2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-2-yl]pyridine (PubChem CID 23186940) has the molecular formula C19H18F6N2O and a molecular weight of 404.35 g/mol. Its IUPAC name is 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-2-yl]pyridine.
| Compound Name | 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 23186940 |
| Molecular Formula | C19H18F6N2O |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-2-yl]pyridine |
| SMILES | FC(F)(F)c1cc(COC2CCCNC2c2ccccn2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F6N2O/c20-18(21,22)13-8-12(9-14(10-13)19(23,24)25)11-28-16-5-3-7-27-17(16)15-4-1-2-6-26-15/h1-2,4,6,8-10,16-17,27H,3,5,7,11H2 |
| InChIKey | WSXRMHMOTWLZSJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |