C17H14ClN3O — CID 2319244
2-chloro-N-(1,3-diphenylpyrazol-4-yl)acetamide (PubChem CID 2319244) has the molecular formula C17H14ClN3O and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-chloro-N-(1,3-diphenylpyrazol-4-yl)acetamide.
| Compound Name | 2-chloro-N-(1,3-diphenylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 2319244 |
| Molecular Formula | C17H14ClN3O |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-chloro-N-(1,3-diphenylpyrazol-4-yl)acetamide |
| SMILES | O=C(CCl)Nc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H14ClN3O/c18-11-16(22)19-15-12-21(14-9-5-2-6-10-14)20-17(15)13-7-3-1-4-8-13/h1-10,12H,11H2,(H,19,22) |
| InChIKey | TTZCSOWBEWACCC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|