C24H21N5O — CID 6906283
2-anilino-N-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]acetamide (PubChem CID 6906283) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-anilino-N-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6906283 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-anilino-N-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]acetamide |
| SMILES | O=C(CNc1ccccc1)N/N=C/c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H21N5O/c30-23(17-25-21-12-6-2-7-13-21)27-26-16-20-18-29(22-14-8-3-9-15-22)28-24(20)19-10-4-1-5-11-19/h1-16,18,25H,17H2,(H,27,30)/b26-16+ |
| InChIKey | IUCUMFICPJQPJT-WGOQTCKBSA-N |
| XLogP | 4.10 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|