C12H17N2+ — CID 2319890
N-[(1R)-1-phenylethyl]-3,4-dihydro-2H-pyrrol-1-ium-5-amine (PubChem CID 2319890) has the molecular formula C12H17N2+ and a molecular weight of 189.28 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-3,4-dihydro-2H-pyrrol-1-ium-5-amine.
| Compound Name | N-[(1R)-1-phenylethyl]-3,4-dihydro-2H-pyrrol-1-ium-5-amine |
|---|---|
| PubChem CID | 2319890 |
| Molecular Formula | C12H17N2+ |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-3,4-dihydro-2H-pyrrol-1-ium-5-amine |
| SMILES | C[C@@H](NC1=[NH+]CCC1)c1ccccc1 |
| InChI | InChI=1S/C12H16N2/c1-10(11-6-3-2-4-7-11)14-12-8-5-9-13-12/h2-4,6-7,10H,5,8-9H2,1H3,(H,13,14)/p+1/t10-/m1/s1 |
| InChIKey | WXMWYKHNRNMBOA-SNVBAGLBSA-O |
| XLogP | 0.61 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |