C10H6F3NO2 — CID 23202872
4-phenyl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one (PubChem CID 23202872) has the molecular formula C10H6F3NO2 and a molecular weight of 229.16 g/mol. Its IUPAC name is 4-phenyl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one.
| Compound Name | 4-phenyl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 23202872 |
| Molecular Formula | C10H6F3NO2 |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 4-phenyl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one |
| SMILES | O=C1OC(C(F)(F)F)=NC1c1ccccc1 |
| InChI | InChI=1S/C10H6F3NO2/c11-10(12,13)9-14-7(8(15)16-9)6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | JREWVNVUSNVVAC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |