About N-propan-2-ylpropan-2-amine;triazol-1-amine
N-propan-2-ylpropan-2-amine;triazol-1-amine (PubChem CID 23203283) has the molecular formula C8H19N5
and a molecular weight of 185.27 g/mol. Its IUPAC name is N-propan-2-ylpropan-2-amine;triazol-1-amine.
Molecular Properties
| Compound Name | N-propan-2-ylpropan-2-amine;triazol-1-amine |
| PubChem CID | 23203283 |
| Molecular Formula | C8H19N5 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | N-propan-2-ylpropan-2-amine;triazol-1-amine |
| SMILES | CC(C)NC(C)C.Nn1ccnn1 |
| InChI | InChI=1S/C6H15N.C2H4N4/c1-5(2)7-6(3)4;3-6-2-1-4-5-6/h5-7H,1-4H3;1-2H,3H2 |
| InChIKey | JCSZCXCPZNOMAF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-propan-2-ylpropan-2-amine;triazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-ylpropan-2-amine;triazol-1-amine?
The IUPAC name of N-propan-2-ylpropan-2-amine;triazol-1-amine (CID 23203283) is N-propan-2-ylpropan-2-amine;triazol-1-amine.
What is the SMILES notation for N-propan-2-ylpropan-2-amine;triazol-1-amine?
The canonical SMILES for N-propan-2-ylpropan-2-amine;triazol-1-amine is CC(C)NC(C)C.Nn1ccnn1.
What is the InChIKey of N-propan-2-ylpropan-2-amine;triazol-1-amine?
The InChIKey is JCSZCXCPZNOMAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C2H4N4/c1-5(2)7-6(3)4;3-6-2-1-4-5-6/h5-7H,1-4H3;1-2H,3H2.
What are the key properties of N-propan-2-ylpropan-2-amine;triazol-1-amine?
N-propan-2-ylpropan-2-amine;triazol-1-amine has a molecular weight of 185.27 g/mol, XLogP of 0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-ylpropan-2-amine;triazol-1-amine is sourced from PubChem (CID 23203283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).