About 2H-benzotriazole;triazol-1-amine
2H-benzotriazole;triazol-1-amine (PubChem CID 174496646) has the molecular formula C8H9N7
and a molecular weight of 203.21 g/mol. Its IUPAC name is 2H-benzotriazole;triazol-1-amine.
Molecular Properties
| Compound Name | 2H-benzotriazole;triazol-1-amine |
| PubChem CID | 174496646 |
| Molecular Formula | C8H9N7 |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2H-benzotriazole;triazol-1-amine |
| SMILES | Nn1ccnn1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.C2H4N4/c1-2-4-6-5(3-1)7-9-8-6;3-6-2-1-4-5-6/h1-4H,(H,7,8,9);1-2H,3H2 |
| InChIKey | WYIWOIOAEKBRTD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2H-benzotriazole;triazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;triazol-1-amine?
The IUPAC name of 2H-benzotriazole;triazol-1-amine (CID 174496646) is 2H-benzotriazole;triazol-1-amine.
What is the SMILES notation for 2H-benzotriazole;triazol-1-amine?
The canonical SMILES for 2H-benzotriazole;triazol-1-amine is Nn1ccnn1.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;triazol-1-amine?
The InChIKey is WYIWOIOAEKBRTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.C2H4N4/c1-2-4-6-5(3-1)7-9-8-6;3-6-2-1-4-5-6/h1-4H,(H,7,8,9);1-2H,3H2.
What are the key properties of 2H-benzotriazole;triazol-1-amine?
2H-benzotriazole;triazol-1-amine has a molecular weight of 203.21 g/mol, XLogP of -0.05, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;triazol-1-amine is sourced from PubChem (CID 174496646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).