C22H22F6N2O2 — CID 23204459
2-[3,5-bis(trifluoromethyl)phenyl]-2-[(4-phenylpiperidin-4-yl)methoxy]acetamide (PubChem CID 23204459) has the molecular formula C22H22F6N2O2 and a molecular weight of 460.42 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-2-[(4-phenylpiperidin-4-yl)methoxy]acetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-[(4-phenylpiperidin-4-yl)methoxy]acetamide |
|---|---|
| PubChem CID | 23204459 |
| Molecular Formula | C22H22F6N2O2 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-[(4-phenylpiperidin-4-yl)methoxy]acetamide |
| SMILES | NC(=O)C(OCC1(c2ccccc2)CCNCC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F6N2O2/c23-21(24,25)16-10-14(11-17(12-16)22(26,27)28)18(19(29)31)32-13-20(6-8-30-9-7-20)15-4-2-1-3-5-15/h1-5,10-12,18,30H,6-9,13H2,(H2,29,31) |
| InChIKey | DNIRQDDPCRREHJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |