C18H18Cl2N2O4 — CID 23204726
N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide (PubChem CID 23204726) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide |
|---|---|
| PubChem CID | 23204726 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cc(N)cc2Cl)cc1OC1CCOC1 |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-24-15-3-2-10(6-16(15)26-12-4-5-25-9-12)18(23)22-17-13(19)7-11(21)8-14(17)20/h2-3,6-8,12H,4-5,9,21H2,1H3,(H,22,23) |
| InChIKey | WMZHWUYAJKITHS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|