About N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide
N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide (PubChem CID 23204726) has the molecular formula C18H18Cl2N2O4
and a molecular weight of 397.26 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide.
Molecular Properties
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide |
| PubChem CID | 23204726 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cc(N)cc2Cl)cc1OC1CCOC1 |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-24-15-3-2-10(6-16(15)26-12-4-5-25-9-12)18(23)22-17-13(19)7-11(21)8-14(17)20/h2-3,6-8,12H,4-5,9,21H2,1H3,(H,22,23) |
| InChIKey | WMZHWUYAJKITHS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide?
The IUPAC name of N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide (CID 23204726) is N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide.
What is the SMILES notation for N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide?
The canonical SMILES for N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide is COc1ccc(C(=O)Nc2c(Cl)cc(N)cc2Cl)cc1OC1CCOC1.
What is the InChIKey of N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide?
The InChIKey is WMZHWUYAJKITHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2N2O4/c1-24-15-3-2-10(6-16(15)26-12-4-5-25-9-12)18(23)22-17-13(19)7-11(21)8-14(17)20/h2-3,6-8,12H,4-5,9,21H2,1H3,(H,22,23).
What are the key properties of N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide?
N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide has a molecular weight of 397.26 g/mol, XLogP of 4.00, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2,6-dichlorophenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide is sourced from PubChem (CID 23204726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).