C20H17F2NO4S — CID 23217148
N-[2-(3,4-dimethoxyphenyl)-4,5-difluorophenyl]benzenesulfonamide (PubChem CID 23217148) has the molecular formula C20H17F2NO4S and a molecular weight of 405.42 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-4,5-difluorophenyl]benzenesulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-4,5-difluorophenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23217148 |
| Molecular Formula | C20H17F2NO4S |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-4,5-difluorophenyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2cc(F)c(F)cc2NS(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H17F2NO4S/c1-26-19-9-8-13(10-20(19)27-2)15-11-16(21)17(22)12-18(15)23-28(24,25)14-6-4-3-5-7-14/h3-12,23H,1-2H3 |
| InChIKey | XFQGDBAIIIXSNA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |