About 3-ethylazepin-2-one
3-ethylazepin-2-one (PubChem CID 23218762) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 3-ethylazepin-2-one.
Molecular Properties
| Compound Name | 3-ethylazepin-2-one |
| PubChem CID | 23218762 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 3-ethylazepin-2-one |
| SMILES | CCc1ccccnc1=O |
| InChI | InChI=1S/C8H9NO/c1-2-7-5-3-4-6-9-8(7)10/h3-6H,2H2,1H3 |
| InChIKey | YWDDYZDLQNGGRW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethylazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylazepin-2-one?
The IUPAC name of 3-ethylazepin-2-one (CID 23218762) is 3-ethylazepin-2-one.
What is the SMILES notation for 3-ethylazepin-2-one?
The canonical SMILES for 3-ethylazepin-2-one is CCc1ccccnc1=O.
What is the InChIKey of 3-ethylazepin-2-one?
The InChIKey is YWDDYZDLQNGGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c1-2-7-5-3-4-6-9-8(7)10/h3-6H,2H2,1H3.
What are the key properties of 3-ethylazepin-2-one?
3-ethylazepin-2-one has a molecular weight of 135.17 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylazepin-2-one is sourced from PubChem (CID 23218762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).