C6H7Cl2N — CID 23221783
3,5-dichlorocyclohexa-1,5-dien-1-amine (PubChem CID 23221783) has the molecular formula C6H7Cl2N and a molecular weight of 164.03 g/mol. Its IUPAC name is 3,5-dichlorocyclohexa-1,5-dien-1-amine.
| Compound Name | 3,5-dichlorocyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 23221783 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.03 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | 3,5-dichlorocyclohexa-1,5-dien-1-amine |
| SMILES | NC1=CC(Cl)CC(Cl)=C1 |
| InChI | InChI=1S/C6H7Cl2N/c7-4-1-5(8)3-6(9)2-4/h2-4H,1,9H2 |
| InChIKey | LJLVBKKISSPBSX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.03 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|