C19H30O5 — CID 23223347
(3,4-dimethoxyphenyl) 4-hydroxy-2-propyloctanoate (PubChem CID 23223347) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl) 4-hydroxy-2-propyloctanoate.
| Compound Name | (3,4-dimethoxyphenyl) 4-hydroxy-2-propyloctanoate |
|---|---|
| PubChem CID | 23223347 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (3,4-dimethoxyphenyl) 4-hydroxy-2-propyloctanoate |
| SMILES | CCCCC(O)CC(CCC)C(=O)Oc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H30O5/c1-5-7-9-15(20)12-14(8-6-2)19(21)24-16-10-11-17(22-3)18(13-16)23-4/h10-11,13-15,20H,5-9,12H2,1-4H3 |
| InChIKey | HFEAKHBFCXPGCA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|