C19H16FN3O3 — CID 2322521
N-(4,6-dimethoxy-5-phenylpyrimidin-2-yl)-4-fluorobenzamide (PubChem CID 2322521) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is N-(4,6-dimethoxy-5-phenylpyrimidin-2-yl)-4-fluorobenzamide.
| Compound Name | N-(4,6-dimethoxy-5-phenylpyrimidin-2-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 2322521 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(4,6-dimethoxy-5-phenylpyrimidin-2-yl)-4-fluorobenzamide |
| SMILES | COc1nc(NC(=O)c2ccc(F)cc2)nc(OC)c1-c1ccccc1 |
| InChI | InChI=1S/C19H16FN3O3/c1-25-17-15(12-6-4-3-5-7-12)18(26-2)23-19(22-17)21-16(24)13-8-10-14(20)11-9-13/h3-11H,1-2H3,(H,21,22,23,24) |
| InChIKey | SRBVSWFJZRRCMY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |