C32H43Cl2N3O3Ru — CID 23230438
1,3-bis(2,4,6-trimethylphenyl)-1,3-diazinane;dichlororuthenium;2-methyl-4-nitro-1-propan-2-yloxybenzene (PubChem CID 23230438) has the molecular formula C32H43Cl2N3O3Ru and a molecular weight of 689.69 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-1,3-diazinane;dichlororuthenium;2-methyl-4-nitro-1-propan-2-yloxybenzene.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-1,3-diazinane;dichlororuthenium;2-methyl-4-nitro-1-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 23230438 |
| Molecular Formula | C32H43Cl2N3O3Ru |
| Molecular Weight | 689.69 g/mol |
| Exact Mass | 689.17 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-1,3-diazinane;dichlororuthenium;2-methyl-4-nitro-1-propan-2-yloxybenzene |
| SMILES | Cc1cc(C)c(N2CCCN(c3c(C)cc(C)cc3C)C2)c(C)c1.Cc1cc([N+](=O)[O-])ccc1OC(C)C.Cl[Ru]Cl |
| InChI | InChI=1S/C22H30N2.C10H13NO3.2ClH.Ru/c1-15-10-17(3)21(18(4)11-15)23-8-7-9-24(14-23)22-19(5)12-16(2)13-20(22)6;1-7(2)14-10-5-4-9(11(12)13)6-8(10)3;;;/h10-13H,7-9,14H2,1-6H3;4-7H,1-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | FIAXZTZIOPSINK-UHFFFAOYSA-L |
| XLogP | 9.28 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.69 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|