C35H45Cl2N2O3Ru- — CID 171726501
dichloro-[(5-nitro-2-propan-2-yloxyphenyl)methylidene]ruthenium;(4R)-1-(2,6-diethylphenyl)-4-(3,5-dimethylphenyl)-2,2,4-trimethylpyrrolidin-5-ide (PubChem CID 171726501) has the molecular formula C35H45Cl2N2O3Ru- and a molecular weight of 713.73 g/mol. Its IUPAC name is dichloro-[(5-nitro-2-propan-2-yloxyphenyl)methylidene]ruthenium;(4R)-1-(2,6-diethylphenyl)-4-(3,5-dimethylphenyl)-2,2,4-trimethylpyrrolidin-5-ide.
| Compound Name | dichloro-[(5-nitro-2-propan-2-yloxyphenyl)methylidene]ruthenium;(4R)-1-(2,6-diethylphenyl)-4-(3,5-dimethylphenyl)-2,2,4-trimethylpyrrolidin-5-ide |
|---|---|
| PubChem CID | 171726501 |
| Molecular Formula | C35H45Cl2N2O3Ru- |
| Molecular Weight | 713.73 g/mol |
| Exact Mass | 713.19 |
| IUPAC Name | dichloro-[(5-nitro-2-propan-2-yloxyphenyl)methylidene]ruthenium;(4R)-1-(2,6-diethylphenyl)-4-(3,5-dimethylphenyl)-2,2,4-trimethylpyrrolidin-5-ide |
| SMILES | CC(C)Oc1ccc([N+](=O)[O-])cc1C=[Ru](Cl)Cl.CCc1cccc(CC)c1N1[CH-][C@@](C)(c2cc(C)cc(C)c2)CC1(C)C |
| InChI | InChI=1S/C25H34N.C10H11NO3.2ClH.Ru/c1-8-20-11-10-12-21(9-2)23(20)26-17-25(7,16-24(26,5)6)22-14-18(3)13-19(4)15-22;1-7(2)14-10-5-4-9(11(12)13)6-8(10)3;;;/h10-15,17H,8-9,16H2,1-7H3;3-7H,1-2H3;2*1H;/q-1;;;;+2/p-2/t25-;;;;/m0..../s1 |
| InChIKey | CECBEBCOKWGWTO-OFIHFMIUSA-L |
| XLogP | 9.99 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.73 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|