C35H50ClNO2Ru- — CID 162436237
chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;1-(2,6-diethylphenyl)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2,2,4-trimethylpyrrolidin-5-ide;methanol (PubChem CID 162436237) has the molecular formula C35H50ClNO2Ru- and a molecular weight of 653.31 g/mol. Its IUPAC name is chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;1-(2,6-diethylphenyl)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2,2,4-trimethylpyrrolidin-5-ide;methanol.
| Compound Name | chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;1-(2,6-diethylphenyl)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2,2,4-trimethylpyrrolidin-5-ide;methanol |
|---|---|
| PubChem CID | 162436237 |
| Molecular Formula | C35H50ClNO2Ru- |
| Molecular Weight | 653.31 g/mol |
| Exact Mass | 653.26 |
| IUPAC Name | chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;1-(2,6-diethylphenyl)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2,2,4-trimethylpyrrolidin-5-ide;methanol |
| SMILES | C=C/C(=C\C=C/C)C1(C)[CH-]N(c2c(CC)cccc2CC)C(C)(C)C1.CC(C)Oc1ccccc1/C=[Ru]\Cl.CO |
| InChI | InChI=1S/C24H34N.C10H12O.CH4O.ClH.Ru/c1-8-12-16-21(11-4)24(7)17-23(5,6)25(18-24)22-19(9-2)14-13-15-20(22)10-3;1-8(2)11-10-7-5-4-6-9(10)3;1-2;;/h8,11-16,18H,4,9-10,17H2,1-3,5-7H3;3-8H,1-2H3;2H,1H3;1H;/q-1;;;;+1/p-1/b12-8-,21-16+;;;; |
| InChIKey | OASYHXWSXRVIEK-FVISTCROSA-M |
| XLogP | 9.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.31 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|