C41H50Cl2N3O3Ru- — CID 164740826
dichloro-[[2-(4-nitrophenoxy)phenyl]methylidene]ruthenium;1-[2,6-di(propan-2-yl)phenyl]-3-[4-methyl-2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide (PubChem CID 164740826) has the molecular formula C41H50Cl2N3O3Ru- and a molecular weight of 804.84 g/mol. Its IUPAC name is dichloro-[[2-(4-nitrophenoxy)phenyl]methylidene]ruthenium;1-[2,6-di(propan-2-yl)phenyl]-3-[4-methyl-2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide.
| Compound Name | dichloro-[[2-(4-nitrophenoxy)phenyl]methylidene]ruthenium;1-[2,6-di(propan-2-yl)phenyl]-3-[4-methyl-2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide |
|---|---|
| PubChem CID | 164740826 |
| Molecular Formula | C41H50Cl2N3O3Ru- |
| Molecular Weight | 804.84 g/mol |
| Exact Mass | 804.23 |
| IUPAC Name | dichloro-[[2-(4-nitrophenoxy)phenyl]methylidene]ruthenium;1-[2,6-di(propan-2-yl)phenyl]-3-[4-methyl-2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide |
| SMILES | Cc1cc(C(C)C)c(N2[CH-]N(c3c(C(C)C)cccc3C(C)C)CC2)c(C(C)C)c1.O=[N+]([O-])c1ccc(Oc2ccccc2C=[Ru](Cl)Cl)cc1 |
| InChI | InChI=1S/C28H41N2.C13H9NO3.2ClH.Ru/c1-18(2)23-11-10-12-24(19(3)4)27(23)29-13-14-30(17-29)28-25(20(5)6)15-22(9)16-26(28)21(7)8;1-10-4-2-3-5-13(10)17-12-8-6-11(7-9-12)14(15)16;;;/h10-12,15-21H,13-14H2,1-9H3;1-9H;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | AQFVPJLDZDAYTJ-UHFFFAOYSA-L |
| XLogP | 12.40 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.84 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|