C30H43Cl2N2O3Ru- — CID 153434951
dichloro-[(5-nitro-2-propan-2-yloxyphenyl)methylidene]ruthenium;1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethylpyrrolidin-5-ide (PubChem CID 153434951) has the molecular formula C30H43Cl2N2O3Ru- and a molecular weight of 651.66 g/mol. Its IUPAC name is dichloro-[(5-nitro-2-propan-2-yloxyphenyl)methylidene]ruthenium;1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethylpyrrolidin-5-ide.
| Compound Name | dichloro-[(5-nitro-2-propan-2-yloxyphenyl)methylidene]ruthenium;1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethylpyrrolidin-5-ide |
|---|---|
| PubChem CID | 153434951 |
| Molecular Formula | C30H43Cl2N2O3Ru- |
| Molecular Weight | 651.66 g/mol |
| Exact Mass | 651.17 |
| IUPAC Name | dichloro-[(5-nitro-2-propan-2-yloxyphenyl)methylidene]ruthenium;1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethylpyrrolidin-5-ide |
| SMILES | CC(C)Oc1ccc([N+](=O)[O-])cc1C=[Ru](Cl)Cl.CC(C)c1cccc(C(C)C)c1N1[CH-]C(C)(C)CC1(C)C |
| InChI | InChI=1S/C20H32N.C10H11NO3.2ClH.Ru/c1-14(2)16-10-9-11-17(15(3)4)18(16)21-13-19(5,6)12-20(21,7)8;1-7(2)14-10-5-4-9(11(12)13)6-8(10)3;;;/h9-11,13-15H,12H2,1-8H3;3-7H,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | URGIHAMOGPOMMY-UHFFFAOYSA-L |
| XLogP | 9.57 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.66 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|